C16H16Cl2N+ — CID 50852190
1-(3,4-dichlorophenyl)-2,2-dimethyl-1,3-dihydroisoindol-2-ium (PubChem CID 50852190) has the molecular formula C16H16Cl2N+ and a molecular weight of 293.22 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2,2-dimethyl-1,3-dihydroisoindol-2-ium.
| Compound Name | 1-(3,4-dichlorophenyl)-2,2-dimethyl-1,3-dihydroisoindol-2-ium |
|---|---|
| PubChem CID | 50852190 |
| Molecular Formula | C16H16Cl2N+ |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2,2-dimethyl-1,3-dihydroisoindol-2-ium |
| SMILES | C[N+]1(C)Cc2ccccc2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2N/c1-19(2)10-12-5-3-4-6-13(12)16(19)11-7-8-14(17)15(18)9-11/h3-9,16H,10H2,1-2H3/q+1 |
| InChIKey | HCMWDWGWQCYGJG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|