About 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide
2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide (PubChem CID 5085246) has the molecular formula C18H20N2O4S
and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide.
Molecular Properties
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide |
| PubChem CID | 5085246 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide |
| SMILES | O=C(Cc1cccc2ccccc12)NNC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H20N2O4S/c21-17(10-13-8-9-25(23,24)12-13)19-20-18(22)11-15-6-3-5-14-4-1-2-7-16(14)15/h1-7,13H,8-12H2,(H,19,21)(H,20,22) |
| InChIKey | SLLAZFLIMVNHFD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide?
The IUPAC name of 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide (CID 5085246) is 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide.
What is the SMILES notation for 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide?
The canonical SMILES for 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide is O=C(Cc1cccc2ccccc12)NNC(=O)CC1CCS(=O)(=O)C1.
What is the InChIKey of 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide?
The InChIKey is SLLAZFLIMVNHFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4S/c21-17(10-13-8-9-25(23,24)12-13)19-20-18(22)11-15-6-3-5-14-4-1-2-7-16(14)15/h1-7,13H,8-12H2,(H,19,21)(H,20,22).
What are the key properties of 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide?
2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide has a molecular weight of 360.44 g/mol, XLogP of 1.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxothiolan-3-yl)-N'-(2-naphthalen-1-ylacetyl)acetohydrazide is sourced from PubChem (CID 5085246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).