C22H23NO2S — CID 50852635
1-[(2E)-2-(6H-benzo[c][1]benzothiepin-11-ylidene)ethyl]piperidine-3-carboxylic acid (PubChem CID 50852635) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-[(2E)-2-(6H-benzo[c][1]benzothiepin-11-ylidene)ethyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(2E)-2-(6H-benzo[c][1]benzothiepin-11-ylidene)ethyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 50852635 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 1-[(2E)-2-(6H-benzo[c][1]benzothiepin-11-ylidene)ethyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C/C=C2\c3ccccc3CSc3ccccc32)C1 |
| InChI | InChI=1S/C22H23NO2S/c24-22(25)16-7-5-12-23(14-16)13-11-19-18-8-2-1-6-17(18)15-26-21-10-4-3-9-20(19)21/h1-4,6,8-11,16H,5,7,12-15H2,(H,24,25)/b19-11+ |
| InChIKey | JOGWVBVHAXXSNI-YBFXNURJSA-N |
| XLogP | 4.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |