About 8-methyl-1-thia-4,8-diazaspiro[4.5]decane
8-methyl-1-thia-4,8-diazaspiro[4.5]decane (PubChem CID 50853150) has the molecular formula C8H16N2S
and a molecular weight of 172.30 g/mol. Its IUPAC name is 8-methyl-1-thia-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-methyl-1-thia-4,8-diazaspiro[4.5]decane |
| PubChem CID | 50853150 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 8-methyl-1-thia-4,8-diazaspiro[4.5]decane |
| SMILES | CN1CCC2(CC1)NCCS2 |
| InChI | InChI=1S/C8H16N2S/c1-10-5-2-8(3-6-10)9-4-7-11-8/h9H,2-7H2,1H3 |
| InChIKey | GOEBBVOXFUDAEC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-1-thia-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-1-thia-4,8-diazaspiro[4.5]decane?
The IUPAC name of 8-methyl-1-thia-4,8-diazaspiro[4.5]decane (CID 50853150) is 8-methyl-1-thia-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 8-methyl-1-thia-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 8-methyl-1-thia-4,8-diazaspiro[4.5]decane is CN1CCC2(CC1)NCCS2.
What is the InChIKey of 8-methyl-1-thia-4,8-diazaspiro[4.5]decane?
The InChIKey is GOEBBVOXFUDAEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2S/c1-10-5-2-8(3-6-10)9-4-7-11-8/h9H,2-7H2,1H3.
What are the key properties of 8-methyl-1-thia-4,8-diazaspiro[4.5]decane?
8-methyl-1-thia-4,8-diazaspiro[4.5]decane has a molecular weight of 172.30 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-1-thia-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 50853150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).