About methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate
methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate (PubChem CID 50853217) has the molecular formula C11H9F3N2O2
and a molecular weight of 258.20 g/mol. Its IUPAC name is methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate |
| PubChem CID | 50853217 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate |
| SMILES | COC(=O)Cc1cn2cc(C(F)(F)F)ccc2n1 |
| InChI | InChI=1S/C11H9F3N2O2/c1-18-10(17)4-8-6-16-5-7(11(12,13)14)2-3-9(16)15-8/h2-3,5-6H,4H2,1H3 |
| InChIKey | ATVOLGBJWBLNQT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The IUPAC name of methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate (CID 50853217) is methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate.
What is the SMILES notation for methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The canonical SMILES for methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate is COC(=O)Cc1cn2cc(C(F)(F)F)ccc2n1.
What is the InChIKey of methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
The InChIKey is ATVOLGBJWBLNQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F3N2O2/c1-18-10(17)4-8-6-16-5-7(11(12,13)14)2-3-9(16)15-8/h2-3,5-6H,4H2,1H3.
What are the key properties of methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate?
methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate has a molecular weight of 258.20 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[6-(trifluoromethyl)imidazo[1,2-a]pyridin-2-yl]acetate is sourced from PubChem (CID 50853217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).