About 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one
3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one (PubChem CID 50853260) has the molecular formula C8H9N3OS
and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one.
Molecular Properties
| Compound Name | 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one |
| PubChem CID | 50853260 |
| Molecular Formula | C8H9N3OS |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one |
| SMILES | Nc1ccc(N2CCSC2=O)nc1 |
| InChI | InChI=1S/C8H9N3OS/c9-6-1-2-7(10-5-6)11-3-4-13-8(11)12/h1-2,5H,3-4,9H2 |
| InChIKey | ZSGQEWGUPSUNGF-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one?
The IUPAC name of 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one (CID 50853260) is 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one.
What is the SMILES notation for 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one?
The canonical SMILES for 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one is Nc1ccc(N2CCSC2=O)nc1.
What is the InChIKey of 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one?
The InChIKey is ZSGQEWGUPSUNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS/c9-6-1-2-7(10-5-6)11-3-4-13-8(11)12/h1-2,5H,3-4,9H2.
What are the key properties of 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one?
3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one has a molecular weight of 195.25 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-amino-2-pyridinyl)-1,3-thiazolidin-2-one is sourced from PubChem (CID 50853260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).