C21H13NO5 — CID 5085353
5-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)-2-hydroxybenzoic acid (PubChem CID 5085353) has the molecular formula C21H13NO5 and a molecular weight of 359.34 g/mol. Its IUPAC name is 5-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)-2-hydroxybenzoic acid.
| Compound Name | 5-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 5085353 |
| Molecular Formula | C21H13NO5 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 5-(5,7-dioxo-6-azatetracyclo[6.5.2.04,15.011,14]pentadeca-1(14),2,4(15),8,10-pentaen-6-yl)-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)CC4)ccc1O |
| InChI | InChI=1S/C21H13NO5/c23-16-8-5-12(9-15(16)21(26)27)22-19(24)13-6-3-10-1-2-11-4-7-14(20(22)25)18(13)17(10)11/h3-9,23H,1-2H2,(H,26,27) |
| InChIKey | OGQKKNSGHNDNFF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|