C21H23N3O2 — CID 50854678
(5E)-3-benzyl-5-[(1-cyclohexylpyrrol-3-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 50854678) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is (5E)-3-benzyl-5-[(1-cyclohexylpyrrol-3-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-benzyl-5-[(1-cyclohexylpyrrol-3-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 50854678 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (5E)-3-benzyl-5-[(1-cyclohexylpyrrol-3-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C/c2ccn(C3CCCCC3)c2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H23N3O2/c25-20-19(22-21(26)24(20)15-16-7-3-1-4-8-16)13-17-11-12-23(14-17)18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18H,2,5-6,9-10,15H2,(H,22,26)/b19-13+ |
| InChIKey | ADIOORCOYUOFDC-CPNJWEJPSA-N |
| XLogP | 4.09 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|