C23H18BrN3O3 — CID 50856209
(5E)-1-(4-bromo-2-methylphenyl)-5-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 50856209) has the molecular formula C23H18BrN3O3 and a molecular weight of 464.32 g/mol. Its IUPAC name is (5E)-1-(4-bromo-2-methylphenyl)-5-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(4-bromo-2-methylphenyl)-5-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50856209 |
| Molecular Formula | C23H18BrN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | (5E)-1-(4-bromo-2-methylphenyl)-5-[(5-methyl-1-phenylpyrrol-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cc(Br)ccc1N1C(=O)NC(=O)/C(=C\c2ccc(C)n2-c2ccccc2)C1=O |
| InChI | InChI=1S/C23H18BrN3O3/c1-14-12-16(24)9-11-20(14)27-22(29)19(21(28)25-23(27)30)13-18-10-8-15(2)26(18)17-6-4-3-5-7-17/h3-13H,1-2H3,(H,25,28,30)/b19-13+ |
| InChIKey | HJGJRELVXWYDDA-CPNJWEJPSA-N |
| XLogP | 4.52 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|