C21H21N3O2 — CID 50857477
2-(3-methoxyphenyl)-N-[(E)-(5-methyl-1-phenylpyrrol-3-yl)methylideneamino]acetamide (PubChem CID 50857477) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[(E)-(5-methyl-1-phenylpyrrol-3-yl)methylideneamino]acetamide.
| Compound Name | 2-(3-methoxyphenyl)-N-[(E)-(5-methyl-1-phenylpyrrol-3-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 50857477 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[(E)-(5-methyl-1-phenylpyrrol-3-yl)methylideneamino]acetamide |
| SMILES | COc1cccc(CC(=O)N/N=C/c2cc(C)n(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-16-11-18(15-24(16)19-8-4-3-5-9-19)14-22-23-21(25)13-17-7-6-10-20(12-17)26-2/h3-12,14-15H,13H2,1-2H3,(H,23,25)/b22-14+ |
| InChIKey | OZECOCOGHPNCKU-HYARGMPZSA-N |
| XLogP | 3.49 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|