C14H16NO3- — CID 5085766
4-(2-methyl-6-propan-2-ylanilino)-4-oxobut-2-enoate (PubChem CID 5085766) has the molecular formula C14H16NO3- and a molecular weight of 246.29 g/mol. Its IUPAC name is 4-(2-methyl-6-propan-2-ylanilino)-4-oxobut-2-enoate.
| Compound Name | 4-(2-methyl-6-propan-2-ylanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 5085766 |
| Molecular Formula | C14H16NO3- |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 4-(2-methyl-6-propan-2-ylanilino)-4-oxobut-2-enoate |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C=CC(=O)[O-] |
| InChI | InChI=1S/C14H17NO3/c1-9(2)11-6-4-5-10(3)14(11)15-12(16)7-8-13(17)18/h4-9H,1-3H3,(H,15,16)(H,17,18)/p-1 |
| InChIKey | YYOHXKVFFRIFJQ-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|