C26H27N5 — CID 50858221
(5E)-2-amino-4,6-dimethyl-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile (PubChem CID 50858221) has the molecular formula C26H27N5 and a molecular weight of 409.54 g/mol. Its IUPAC name is (5E)-2-amino-4,6-dimethyl-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile.
| Compound Name | (5E)-2-amino-4,6-dimethyl-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 50858221 |
| Molecular Formula | C26H27N5 |
| Molecular Weight | 409.54 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (5E)-2-amino-4,6-dimethyl-5-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]cyclopenta[b]pyridine-3,7-dicarbonitrile |
| SMILES | CC1=C(C#N)c2nc(N)c(C#N)c(C)c2/C1=C/c1ccc2c(c1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C26H27N5/c1-14-11-26(4,5)31(6)22-8-7-17(9-18(14)22)10-19-15(2)20(12-27)24-23(19)16(3)21(13-28)25(29)30-24/h7-10,14H,11H2,1-6H3,(H2,29,30)/b19-10+ |
| InChIKey | MIHGMGLLNRZQDT-VXLYETTFSA-N |
| XLogP | 5.42 |
| TPSA | 89.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.54 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|