C21H18ClNO2 — CID 5085866
2-(4-chlorophenyl)-N-[4-(3-methylphenoxy)phenyl]acetamide (PubChem CID 5085866) has the molecular formula C21H18ClNO2 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[4-(3-methylphenoxy)phenyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[4-(3-methylphenoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 5085866 |
| Molecular Formula | C21H18ClNO2 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[4-(3-methylphenoxy)phenyl]acetamide |
| SMILES | Cc1cccc(Oc2ccc(NC(=O)Cc3ccc(Cl)cc3)cc2)c1 |
| InChI | InChI=1S/C21H18ClNO2/c1-15-3-2-4-20(13-15)25-19-11-9-18(10-12-19)23-21(24)14-16-5-7-17(22)8-6-16/h2-13H,14H2,1H3,(H,23,24) |
| InChIKey | XMSUTFKPTKUHBM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |