C22H28FN3 — CID 50859880
4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline (PubChem CID 50859880) has the molecular formula C22H28FN3 and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 50859880 |
| Molecular Formula | C22H28FN3 |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 4-[(7-fluoro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline |
| SMILES | CC1CC(C)(C)N(C)c2cc(F)c(/C=N/c3ccc(N(C)C)cc3)cc21 |
| InChI | InChI=1S/C22H28FN3/c1-15-13-22(2,3)26(6)21-12-20(23)16(11-19(15)21)14-24-17-7-9-18(10-8-17)25(4)5/h7-12,14-15H,13H2,1-6H3/b24-14+ |
| InChIKey | VZPMQBMNZIOOKT-ZVHZXABRSA-N |
| XLogP | 5.36 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|