C23H29N3O2 — CID 50860072
N-[4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide (PubChem CID 50860072) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide.
| Compound Name | N-[4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide |
|---|---|
| PubChem CID | 50860072 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[4-[(7-methoxy-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]phenyl]acetamide |
| SMILES | COc1cc2c(cc1/C=N/c1ccc(NC(C)=O)cc1)C(C)CC(C)(C)N2C |
| InChI | InChI=1S/C23H29N3O2/c1-15-13-23(3,4)26(5)21-12-22(28-6)17(11-20(15)21)14-24-18-7-9-19(10-8-18)25-16(2)27/h7-12,14-15H,13H2,1-6H3,(H,25,27)/b24-14+ |
| InChIKey | KAKJTELXQYHDAY-ZVHZXABRSA-N |
| XLogP | 5.13 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|