C23H31N3 — CID 50860641
4-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline (PubChem CID 50860641) has the molecular formula C23H31N3 and a molecular weight of 349.52 g/mol. Its IUPAC name is 4-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline.
| Compound Name | 4-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 50860641 |
| Molecular Formula | C23H31N3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.25 |
| IUPAC Name | 4-[(1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylideneamino]-N,N-dimethylaniline |
| SMILES | CCN1c2ccc(/C=N/c3ccc(N(C)C)cc3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C23H31N3/c1-7-26-22-13-8-18(14-21(22)17(2)15-23(26,3)4)16-24-19-9-11-20(12-10-19)25(5)6/h8-14,16-17H,7,15H2,1-6H3/b24-16+ |
| InChIKey | RSHWDLUDWNSPAB-LFVJCYFKSA-N |
| XLogP | 5.62 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|