C28H31N5 — CID 50860798
(5E)-2-amino-5-[(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile (PubChem CID 50860798) has the molecular formula C28H31N5 and a molecular weight of 437.59 g/mol. Its IUPAC name is (5E)-2-amino-5-[(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile.
| Compound Name | (5E)-2-amino-5-[(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 50860798 |
| Molecular Formula | C28H31N5 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (5E)-2-amino-5-[(1-ethyl-2,2,4,7-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
| SMILES | CCN1c2cc(C)c(/C=C3\C(C)=C(C#N)c4nc(N)c(C#N)c(C)c43)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C28H31N5/c1-8-33-24-9-15(2)19(10-20(24)16(3)12-28(33,6)7)11-21-17(4)22(13-29)26-25(21)18(5)23(14-30)27(31)32-26/h9-11,16H,8,12H2,1-7H3,(H2,31,32)/b21-11+ |
| InChIKey | BOROBSBEYAWXAJ-SRZZPIQSSA-N |
| XLogP | 6.12 |
| TPSA | 89.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|