C21H24ClFN2 — CID 50861005
1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-fluorophenyl)methanimine (PubChem CID 50861005) has the molecular formula C21H24ClFN2 and a molecular weight of 358.89 g/mol. Its IUPAC name is 1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-fluorophenyl)methanimine.
| Compound Name | 1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-fluorophenyl)methanimine |
|---|---|
| PubChem CID | 50861005 |
| Molecular Formula | C21H24ClFN2 |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-(7-chloro-1-ethyl-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)-N-(3-fluorophenyl)methanimine |
| SMILES | CCN1c2cc(Cl)c(/C=N/c3cccc(F)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C21H24ClFN2/c1-5-25-20-11-19(22)15(9-18(20)14(2)12-21(25,3)4)13-24-17-8-6-7-16(23)10-17/h6-11,13-14H,5,12H2,1-4H3/b24-13+ |
| InChIKey | RMRUIGJAVVIZTK-ZMOGYAJESA-N |
| XLogP | 6.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|