C27H30FN3O4S — CID 50862006
2-[(5E)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 50862006) has the molecular formula C27H30FN3O4S and a molecular weight of 511.62 g/mol. Its IUPAC name is 2-[(5E)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 50862006 |
| Molecular Formula | C27H30FN3O4S |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 2-[(5E)-5-[(1-ethyl-7-methoxy-2,2,4-trimethyl-3,4-dihydroquinolin-6-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN1c2cc(OC)c(/C=C3/SC(=O)N(CC(=O)Nc4ccc(F)cc4)C3=O)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C27H30FN3O4S/c1-6-31-21-13-22(35-5)17(11-20(21)16(2)14-27(31,3)4)12-23-25(33)30(26(34)36-23)15-24(32)29-19-9-7-18(28)8-10-19/h7-13,16H,6,14-15H2,1-5H3,(H,29,32)/b23-12+ |
| InChIKey | XTMUTKYZEIBDKL-FSJBWODESA-N |
| XLogP | 5.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|