About 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione
4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione (PubChem CID 5086211) has the molecular formula C21H23NO4
and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione.
Molecular Properties
| Compound Name | 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione |
| PubChem CID | 5086211 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione |
| SMILES | CCC(CCC(=O)c1ccccc1)(CCC(=O)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H23NO4/c1-2-21(22(25)26,15-13-19(23)17-9-5-3-6-10-17)16-14-20(24)18-11-7-4-8-12-18/h3-12H,2,13-16H2,1H3 |
| InChIKey | VZMMNHGACLYXQZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione?
The IUPAC name of 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione (CID 5086211) is 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione.
What is the SMILES notation for 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione?
The canonical SMILES for 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione is CCC(CCC(=O)c1ccccc1)(CCC(=O)c1ccccc1)[N+](=O)[O-].
What is the InChIKey of 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione?
The InChIKey is VZMMNHGACLYXQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO4/c1-2-21(22(25)26,15-13-19(23)17-9-5-3-6-10-17)16-14-20(24)18-11-7-4-8-12-18/h3-12H,2,13-16H2,1H3.
What are the key properties of 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione?
4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione has a molecular weight of 353.42 g/mol, XLogP of 4.74, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-nitro-1,7-diphenylheptane-1,7-dione is sourced from PubChem (CID 5086211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).