C24H31ClN2 — CID 50863433
1-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(3,4-dimethylphenyl)methanimine (PubChem CID 50863433) has the molecular formula C24H31ClN2 and a molecular weight of 382.98 g/mol. Its IUPAC name is 1-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(3,4-dimethylphenyl)methanimine.
| Compound Name | 1-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(3,4-dimethylphenyl)methanimine |
|---|---|
| PubChem CID | 50863433 |
| Molecular Formula | C24H31ClN2 |
| Molecular Weight | 382.98 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-(7-chloro-2,2,4-trimethyl-1-propyl-3,4-dihydroquinolin-6-yl)-N-(3,4-dimethylphenyl)methanimine |
| SMILES | CCCN1c2cc(Cl)c(/C=N/c3ccc(C)c(C)c3)cc2C(C)CC1(C)C |
| InChI | InChI=1S/C24H31ClN2/c1-7-10-27-23-13-22(25)19(12-21(23)18(4)14-24(27,5)6)15-26-20-9-8-16(2)17(3)11-20/h8-9,11-13,15,18H,7,10,14H2,1-6H3/b26-15+ |
| InChIKey | TYMFROYPQGSUDT-CVKSISIWSA-N |
| XLogP | 7.21 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.98 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|