C27H39N9O12 — CID 5086374
1,3,5-tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 5086374) has the molecular formula C27H39N9O12 and a molecular weight of 681.66 g/mol. Its IUPAC name is 1,3,5-tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3,5-tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5086374 |
| Molecular Formula | C27H39N9O12 |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | 1,3,5-tris[3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2-hydroxypropyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | CC1(C)NC(=O)N(CC(O)Cn2c(=O)n(CC(O)CN3C(=O)NC(C)(C)C3=O)c(=O)n(CC(O)CN3C(=O)NC(C)(C)C3=O)c2=O)C1=O |
| InChI | InChI=1S/C27H39N9O12/c1-25(2)16(40)31(19(43)28-25)7-13(37)10-34-22(46)35(11-14(38)8-32-17(41)26(3,4)29-20(32)44)24(48)36(23(34)47)12-15(39)9-33-18(42)27(5,6)30-21(33)45/h13-15,37-39H,7-12H2,1-6H3,(H,28,43)(H,29,44)(H,30,45) |
| InChIKey | DHNYXBLTTAVBLW-UHFFFAOYSA-N |
| XLogP | -4.75 |
| TPSA | 274.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | -4.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|