About methyl 4-(diethylamino)benzoate
methyl 4-(diethylamino)benzoate (PubChem CID 5086469) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is methyl 4-(diethylamino)benzoate.
Molecular Properties
| Compound Name | methyl 4-(diethylamino)benzoate |
| PubChem CID | 5086469 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | methyl 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-4-13(5-2)11-8-6-10(7-9-11)12(14)15-3/h6-9H,4-5H2,1-3H3 |
| InChIKey | NRZLHHHHUNKJOP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-(diethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(diethylamino)benzoate?
The IUPAC name of methyl 4-(diethylamino)benzoate (CID 5086469) is methyl 4-(diethylamino)benzoate.
What is the SMILES notation for methyl 4-(diethylamino)benzoate?
The canonical SMILES for methyl 4-(diethylamino)benzoate is CCN(CC)c1ccc(C(=O)OC)cc1.
What is the InChIKey of methyl 4-(diethylamino)benzoate?
The InChIKey is NRZLHHHHUNKJOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-4-13(5-2)11-8-6-10(7-9-11)12(14)15-3/h6-9H,4-5H2,1-3H3.
What are the key properties of methyl 4-(diethylamino)benzoate?
methyl 4-(diethylamino)benzoate has a molecular weight of 207.27 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(diethylamino)benzoate is sourced from PubChem (CID 5086469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).