C25H24FN3O3S — CID 50865735
(5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1-(4-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 50865735) has the molecular formula C25H24FN3O3S and a molecular weight of 465.55 g/mol. Its IUPAC name is (5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1-(4-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | (5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1-(4-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 50865735 |
| Molecular Formula | C25H24FN3O3S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | (5Z)-5-[(7-fluoro-1,2,2,4-tetramethylquinolin-6-yl)methylidene]-1-(4-methoxyphenyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3cc4c(cc3F)N(C)C(C)(C)C=C4C)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C25H24FN3O3S/c1-14-13-25(2,3)28(4)21-12-20(26)15(10-18(14)21)11-19-22(30)27-24(33)29(23(19)31)16-6-8-17(32-5)9-7-16/h6-13H,1-5H3,(H,27,30,33)/b19-11- |
| InChIKey | LWNDBBYQFVDSIH-ODLFYWEKSA-N |
| XLogP | 4.30 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|