About 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione
2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione (PubChem CID 5086864) has the molecular formula C19H30O4
and a molecular weight of 322.44 g/mol. Its IUPAC name is 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione.
Molecular Properties
| Compound Name | 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione |
| PubChem CID | 5086864 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCCCCCC1=C(OC)C(=O)C=C(OC)C1=O |
| InChI | InChI=1S/C19H30O4/c1-4-5-6-7-8-9-10-11-12-13-15-18(21)17(22-2)14-16(20)19(15)23-3/h14H,4-13H2,1-3H3 |
| InChIKey | AUSJVHOZNUUITQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione?
The IUPAC name of 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione (CID 5086864) is 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione.
What is the SMILES notation for 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione?
The canonical SMILES for 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione is CCCCCCCCCCCC1=C(OC)C(=O)C=C(OC)C1=O.
What is the InChIKey of 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione?
The InChIKey is AUSJVHOZNUUITQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4/c1-4-5-6-7-8-9-10-11-12-13-15-18(21)17(22-2)14-16(20)19(15)23-3/h14H,4-13H2,1-3H3.
What are the key properties of 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione?
2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione has a molecular weight of 322.44 g/mol, XLogP of 4.49, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-3-undecylcyclohexa-2,5-diene-1,4-dione is sourced from PubChem (CID 5086864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).