C28H31FN4O3 — CID 50869585
2-[(4E)-4-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 50869585) has the molecular formula C28H31FN4O3 and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-[(4E)-4-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50869585 |
| Molecular Formula | C28H31FN4O3 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-[(4E)-4-[(7-fluoro-2,2,4-trimethyl-1-propylquinolin-6-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | CCCN1c2cc(F)c(/C=C3/NC(=O)N(CC(=O)Nc4ccc(C)cc4)C3=O)cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C28H31FN4O3/c1-6-11-33-24-14-22(29)19(12-21(24)18(3)15-28(33,4)5)13-23-26(35)32(27(36)31-23)16-25(34)30-20-9-7-17(2)8-10-20/h7-10,12-15H,6,11,16H2,1-5H3,(H,30,34)(H,31,36)/b23-13+ |
| InChIKey | XKJLWSFKPWQCKK-YDZHTSKRSA-N |
| XLogP | 5.08 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|