C14H6Br2N2O4S2 — CID 50870168
(5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50870168) has the molecular formula C14H6Br2N2O4S2 and a molecular weight of 490.15 g/mol. Its IUPAC name is (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50870168 |
| Molecular Formula | C14H6Br2N2O4S2 |
| Molecular Weight | 490.15 g/mol |
| Exact Mass | 487.81 |
| IUPAC Name | (5E)-5-[(4,5-dibromofuran-2-yl)methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2cc(Br)c(Br)o2)SC(=S)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H6Br2N2O4S2/c15-10-5-9(22-12(10)16)6-11-13(19)17(14(23)24-11)7-1-3-8(4-2-7)18(20)21/h1-6H/b11-6+ |
| InChIKey | USXUCWFQLRSNOM-IZZDOVSWSA-N |
| XLogP | 5.12 |
| TPSA | 76.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.15 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|