C20H13BrF3NO5S2 — CID 50871202
2-[2-bromo-6-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 50871202) has the molecular formula C20H13BrF3NO5S2 and a molecular weight of 548.36 g/mol. Its IUPAC name is 2-[2-bromo-6-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 50871202 |
| Molecular Formula | C20H13BrF3NO5S2 |
| Molecular Weight | 548.36 g/mol |
| Exact Mass | 546.94 |
| IUPAC Name | 2-[2-bromo-6-methoxy-4-[(E)-[4-oxo-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C2/SC(=S)N(c3cccc(C(F)(F)F)c3)C2=O)cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C20H13BrF3NO5S2/c1-29-14-6-10(5-13(21)17(14)30-9-16(26)27)7-15-18(28)25(19(31)32-15)12-4-2-3-11(8-12)20(22,23)24/h2-8H,9H2,1H3,(H,26,27)/b15-7+ |
| InChIKey | XOROTZANGBHHIM-VIZOYTHASA-N |
| XLogP | 5.35 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|