C27H18N2O4S2 — CID 50871957
(5E)-5-[[2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50871957) has the molecular formula C27H18N2O4S2 and a molecular weight of 498.59 g/mol. Its IUPAC name is (5E)-5-[[2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50871957 |
| Molecular Formula | C27H18N2O4S2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | (5E)-5-[[2-(naphthalen-1-ylmethoxy)phenyl]methylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccccc2OCc2cccc3ccccc23)SC(=S)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H18N2O4S2/c30-26-25(35-27(34)28(26)21-12-14-22(15-13-21)29(31)32)16-19-7-2-4-11-24(19)33-17-20-9-5-8-18-6-1-3-10-23(18)20/h1-16H,17H2/b25-16+ |
| InChIKey | LPUZJHNWAYKWPX-PCLIKHOPSA-N |
| XLogP | 6.73 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|