C21H19FN2O4S2 — CID 50872434
(5E)-3-tert-butyl-5-[[2-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50872434) has the molecular formula C21H19FN2O4S2 and a molecular weight of 446.53 g/mol. Its IUPAC name is (5E)-3-tert-butyl-5-[[2-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-tert-butyl-5-[[2-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50872434 |
| Molecular Formula | C21H19FN2O4S2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | (5E)-3-tert-butyl-5-[[2-[(4-fluorophenyl)methoxy]-5-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CC(C)(C)N1C(=O)/C(=C\c2cc([N+](=O)[O-])ccc2OCc2ccc(F)cc2)SC1=S |
| InChI | InChI=1S/C21H19FN2O4S2/c1-21(2,3)23-19(25)18(30-20(23)29)11-14-10-16(24(26)27)8-9-17(14)28-12-13-4-6-15(22)7-5-13/h4-11H,12H2,1-3H3/b18-11+ |
| InChIKey | GBFMMTXZUPCITP-WOJGMQOQSA-N |
| XLogP | 5.31 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|