C12H13NOS2 — CID 50873042
2-sulfanylidene-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one (PubChem CID 50873042) has the molecular formula C12H13NOS2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 2-sulfanylidene-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-sulfanylidene-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50873042 |
| Molecular Formula | C12H13NOS2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-sulfanylidene-3-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)c(N2C(=O)CSC2=S)c(C)c1 |
| InChI | InChI=1S/C12H13NOS2/c1-7-4-8(2)11(9(3)5-7)13-10(14)6-16-12(13)15/h4-5H,6H2,1-3H3 |
| InChIKey | IHRRZLHPZMIZJN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|