About dimethyl 1H-pyrrole-3,4-dicarboxylate
dimethyl 1H-pyrrole-3,4-dicarboxylate (PubChem CID 5087326) has the molecular formula C8H9NO4
and a molecular weight of 183.16 g/mol. Its IUPAC name is dimethyl 1H-pyrrole-3,4-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 1H-pyrrole-3,4-dicarboxylate |
| PubChem CID | 5087326 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | dimethyl 1H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)c1c[nH]cc1C(=O)OC |
| InChI | InChI=1S/C8H9NO4/c1-12-7(10)5-3-9-4-6(5)8(11)13-2/h3-4,9H,1-2H3 |
| InChIKey | HEDIMOSXPHKSMJ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dimethyl 1H-pyrrole-3,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 1H-pyrrole-3,4-dicarboxylate?
The IUPAC name of dimethyl 1H-pyrrole-3,4-dicarboxylate (CID 5087326) is dimethyl 1H-pyrrole-3,4-dicarboxylate.
What is the SMILES notation for dimethyl 1H-pyrrole-3,4-dicarboxylate?
The canonical SMILES for dimethyl 1H-pyrrole-3,4-dicarboxylate is COC(=O)c1c[nH]cc1C(=O)OC.
What is the InChIKey of dimethyl 1H-pyrrole-3,4-dicarboxylate?
The InChIKey is HEDIMOSXPHKSMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4/c1-12-7(10)5-3-9-4-6(5)8(11)13-2/h3-4,9H,1-2H3.
What are the key properties of dimethyl 1H-pyrrole-3,4-dicarboxylate?
dimethyl 1H-pyrrole-3,4-dicarboxylate has a molecular weight of 183.16 g/mol, XLogP of 0.59, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 1H-pyrrole-3,4-dicarboxylate is sourced from PubChem (CID 5087326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).