C28H28N4O4 — CID 50874287
(5E)-5-[[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]methylidene]-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 50874287) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is (5E)-5-[[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]methylidene]-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]methylidene]-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50874287 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (5E)-5-[[2,5-dimethyl-1-(4-morpholin-4-ylphenyl)pyrrol-3-yl]methylidene]-1-(3-methylphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1cccc(N2C(=O)NC(=O)/C(=C\c3cc(C)n(-c4ccc(N5CCOCC5)cc4)c3C)C2=O)c1 |
| InChI | InChI=1S/C28H28N4O4/c1-18-5-4-6-24(15-18)32-27(34)25(26(33)29-28(32)35)17-21-16-19(2)31(20(21)3)23-9-7-22(8-10-23)30-11-13-36-14-12-30/h4-10,15-17H,11-14H2,1-3H3,(H,29,33,35)/b25-17+ |
| InChIKey | NVKVUFBVZRVUAQ-KOEQRZSOSA-N |
| XLogP | 3.91 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|