About 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline
4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline (PubChem CID 50874428) has the molecular formula C15H12BrClN2O
and a molecular weight of 351.63 g/mol. Its IUPAC name is 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline.
Molecular Properties
| Compound Name | 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline |
| PubChem CID | 50874428 |
| Molecular Formula | C15H12BrClN2O |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline |
| SMILES | CCc1cc(Br)c2oc(-c3ccc(N)c(Cl)c3)nc2c1 |
| InChI | InChI=1S/C15H12BrClN2O/c1-2-8-5-10(16)14-13(6-8)19-15(20-14)9-3-4-12(18)11(17)7-9/h3-7H,2,18H2,1H3 |
| InChIKey | RMLCSEZKVOTFCV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline?
The IUPAC name of 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline (CID 50874428) is 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline.
What is the SMILES notation for 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline?
The canonical SMILES for 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline is CCc1cc(Br)c2oc(-c3ccc(N)c(Cl)c3)nc2c1.
What is the InChIKey of 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline?
The InChIKey is RMLCSEZKVOTFCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrClN2O/c1-2-8-5-10(16)14-13(6-8)19-15(20-14)9-3-4-12(18)11(17)7-9/h3-7H,2,18H2,1H3.
What are the key properties of 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline?
4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline has a molecular weight of 351.63 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(7-bromo-5-ethyl-1,3-benzoxazol-2-yl)-2-chloroaniline is sourced from PubChem (CID 50874428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).