C19H18BrN3O3 — CID 50874670
N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenoxybutanamide (PubChem CID 50874670) has the molecular formula C19H18BrN3O3 and a molecular weight of 416.28 g/mol. Its IUPAC name is N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenoxybutanamide.
| Compound Name | N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenoxybutanamide |
|---|---|
| PubChem CID | 50874670 |
| Molecular Formula | C19H18BrN3O3 |
| Molecular Weight | 416.28 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-[[3-(3-bromophenyl)-1,2,4-oxadiazol-5-yl]methyl]-4-phenoxybutanamide |
| SMILES | O=C(CCCOc1ccccc1)NCc1nc(-c2cccc(Br)c2)no1 |
| InChI | InChI=1S/C19H18BrN3O3/c20-15-7-4-6-14(12-15)19-22-18(26-23-19)13-21-17(24)10-5-11-25-16-8-2-1-3-9-16/h1-4,6-9,12H,5,10-11,13H2,(H,21,24) |
| InChIKey | ROCFUUWAGXLQDV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.28 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|