C13H10F3N2O2- — CID 5087530
4-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoate (PubChem CID 5087530) has the molecular formula C13H10F3N2O2- and a molecular weight of 283.23 g/mol. Its IUPAC name is 4-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoate.
| Compound Name | 4-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 5087530 |
| Molecular Formula | C13H10F3N2O2- |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-[[5-methyl-3-(trifluoromethyl)pyrazol-1-yl]methyl]benzoate |
| SMILES | Cc1cc(C(F)(F)F)nn1Cc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C13H11F3N2O2/c1-8-6-11(13(14,15)16)17-18(8)7-9-2-4-10(5-3-9)12(19)20/h2-6H,7H2,1H3,(H,19,20)/p-1 |
| InChIKey | SKAXAMCEFUXCJM-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |