C23H14N2O4S — CID 5087562
N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-4-oxochromene-2-carboxamide (PubChem CID 5087562) has the molecular formula C23H14N2O4S and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 5087562 |
| Molecular Formula | C23H14N2O4S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-hydroxyphenyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(Nc1ccc(O)c(-c2nc3ccccc3s2)c1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C23H14N2O4S/c26-17-10-9-13(11-15(17)23-25-16-6-2-4-8-21(16)30-23)24-22(28)20-12-18(27)14-5-1-3-7-19(14)29-20/h1-12,26H,(H,24,28) |
| InChIKey | KPOZEYGBODQCCY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|