C33H29N5O3S — CID 50876078
2-[5-[5-(2-oxo-3-pyridin-3-ylpropyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]pentyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 50876078) has the molecular formula C33H29N5O3S and a molecular weight of 575.69 g/mol. Its IUPAC name is 2-[5-[5-(2-oxo-3-pyridin-3-ylpropyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]pentyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[5-[5-(2-oxo-3-pyridin-3-ylpropyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]pentyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 50876078 |
| Molecular Formula | C33H29N5O3S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 2-[5-[5-(2-oxo-3-pyridin-3-ylpropyl)sulfanyl-4-phenyl-1,2,4-triazol-3-yl]pentyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C(CSc1nnc(CCCCCN2C(=O)c3cccc4cccc(c34)C2=O)n1-c1ccccc1)Cc1cccnc1 |
| InChI | InChI=1S/C33H29N5O3S/c39-26(20-23-10-9-18-34-21-23)22-42-33-36-35-29(38(33)25-13-3-1-4-14-25)17-5-2-6-19-37-31(40)27-15-7-11-24-12-8-16-28(30(24)27)32(37)41/h1,3-4,7-16,18,21H,2,5-6,17,19-20,22H2 |
| InChIKey | PXNWOOXMMBVIMM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|