C13H11NO4 — CID 50877398
8-methoxy-2,3-dihydro-[1,4]dioxepino[6,5-c]quinolin-5-one (PubChem CID 50877398) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 8-methoxy-2,3-dihydro-[1,4]dioxepino[6,5-c]quinolin-5-one.
| Compound Name | 8-methoxy-2,3-dihydro-[1,4]dioxepino[6,5-c]quinolin-5-one |
|---|---|
| PubChem CID | 50877398 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 8-methoxy-2,3-dihydro-[1,4]dioxepino[6,5-c]quinolin-5-one |
| SMILES | COc1cccc2c3c(cnc12)C(=O)OCCO3 |
| InChI | InChI=1S/C13H11NO4/c1-16-10-4-2-3-8-11(10)14-7-9-12(8)17-5-6-18-13(9)15/h2-4,7H,5-6H2,1H3 |
| InChIKey | OHVDCQNKYFVPFY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |