About 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine
7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine (PubChem CID 50877923) has the molecular formula C19H20N2O4
and a molecular weight of 340.38 g/mol. Its IUPAC name is 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine.
Molecular Properties
| Compound Name | 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine |
| PubChem CID | 50877923 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine |
| SMILES | COc1ccc2c(Nc3cc(OC)c(OC)c(OC)c3)ccnc2c1 |
| InChI | InChI=1S/C19H20N2O4/c1-22-13-5-6-14-15(7-8-20-16(14)11-13)21-12-9-17(23-2)19(25-4)18(10-12)24-3/h5-11H,1-4H3,(H,20,21) |
| InChIKey | GRKVQPWSPUXGKV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine?
The IUPAC name of 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine (CID 50877923) is 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine.
What is the SMILES notation for 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine?
The canonical SMILES for 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine is COc1ccc2c(Nc3cc(OC)c(OC)c(OC)c3)ccnc2c1.
What is the InChIKey of 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine?
The InChIKey is GRKVQPWSPUXGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O4/c1-22-13-5-6-14-15(7-8-20-16(14)11-13)21-12-9-17(23-2)19(25-4)18(10-12)24-3/h5-11H,1-4H3,(H,20,21).
What are the key properties of 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine?
7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine has a molecular weight of 340.38 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N-(3,4,5-trimethoxyphenyl)quinolin-4-amine is sourced from PubChem (CID 50877923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).