About 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione
2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 50878146) has the molecular formula C18H12N2O2S
and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione |
| PubChem CID | 50878146 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cccc(-c2nccs2)c1 |
| InChI | InChI=1S/C18H12N2O2S/c21-17-14-6-1-2-7-15(14)18(22)20(17)11-12-4-3-5-13(10-12)16-19-8-9-23-16/h1-10H,11H2 |
| InChIKey | GDAPSWYBGPZFQO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione?
The IUPAC name of 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione (CID 50878146) is 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione?
The canonical SMILES for 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1Cc1cccc(-c2nccs2)c1.
What is the InChIKey of 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione?
The InChIKey is GDAPSWYBGPZFQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O2S/c21-17-14-6-1-2-7-15(14)18(22)20(17)11-12-4-3-5-13(10-12)16-19-8-9-23-16/h1-10H,11H2.
What are the key properties of 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione?
2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione has a molecular weight of 320.37 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3-(1,3-thiazol-2-yl)phenyl]methyl]isoindole-1,3-dione is sourced from PubChem (CID 50878146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).