C13H13ClN2OS — CID 50878255
1-(4-chlorophenyl)-4-sulfanylidene-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyrimidin-2-one (PubChem CID 50878255) has the molecular formula C13H13ClN2OS and a molecular weight of 280.78 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-sulfanylidene-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyrimidin-2-one.
| Compound Name | 1-(4-chlorophenyl)-4-sulfanylidene-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyrimidin-2-one |
|---|---|
| PubChem CID | 50878255 |
| Molecular Formula | C13H13ClN2OS |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-(4-chlorophenyl)-4-sulfanylidene-5,6,7,7a-tetrahydro-4aH-cyclopenta[d]pyrimidin-2-one |
| SMILES | O=C1NC(=S)C2CCCC2N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2OS/c14-8-4-6-9(7-5-8)16-11-3-1-2-10(11)12(18)15-13(16)17/h4-7,10-11H,1-3H2,(H,15,17,18) |
| InChIKey | OGORLLAMIGKEER-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|