C12H19N5O2S2 — CID 50878403
(E)-1-N-methyl-1-N'-[2-[(6-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine (PubChem CID 50878403) has the molecular formula C12H19N5O2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is (E)-1-N-methyl-1-N'-[2-[(6-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | (E)-1-N-methyl-1-N'-[2-[(6-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 50878403 |
| Molecular Formula | C12H19N5O2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (E)-1-N-methyl-1-N'-[2-[(6-methyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-5-yl)methylsulfanyl]ethyl]-2-nitroethene-1,1-diamine |
| SMILES | CN/C(=C\[N+](=O)[O-])NCCSCc1c(C)nc2n1CCS2 |
| InChI | InChI=1S/C12H19N5O2S2/c1-9-10(16-4-6-21-12(16)15-9)8-20-5-3-14-11(13-2)7-17(18)19/h7,13-14H,3-6,8H2,1-2H3/b11-7+ |
| InChIKey | VVAMDADBSGZTDS-YRNVUSSQSA-N |
| XLogP | 1.42 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|