C15H11ClN4O2S — CID 50878851
2-N-(5-chloro-1,3-benzoxazol-2-yl)-4-methoxy-1,3-benzothiazole-2,6-diamine (PubChem CID 50878851) has the molecular formula C15H11ClN4O2S and a molecular weight of 346.80 g/mol. Its IUPAC name is 2-N-(5-chloro-1,3-benzoxazol-2-yl)-4-methoxy-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(5-chloro-1,3-benzoxazol-2-yl)-4-methoxy-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 50878851 |
| Molecular Formula | C15H11ClN4O2S |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-N-(5-chloro-1,3-benzoxazol-2-yl)-4-methoxy-1,3-benzothiazole-2,6-diamine |
| SMILES | COc1cc(N)cc2sc(Nc3nc4cc(Cl)ccc4o3)nc12 |
| InChI | InChI=1S/C15H11ClN4O2S/c1-21-11-5-8(17)6-12-13(11)19-15(23-12)20-14-18-9-4-7(16)2-3-10(9)22-14/h2-6H,17H2,1H3,(H,18,19,20) |
| InChIKey | ZKZHIWWSDGFFMK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|