C16H13N5 — CID 50879825
2-[3-methyl-4-(1,2,4-triazol-4-yl)phenyl]-1H-benzimidazole (PubChem CID 50879825) has the molecular formula C16H13N5 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2-[3-methyl-4-(1,2,4-triazol-4-yl)phenyl]-1H-benzimidazole.
| Compound Name | 2-[3-methyl-4-(1,2,4-triazol-4-yl)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 50879825 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[3-methyl-4-(1,2,4-triazol-4-yl)phenyl]-1H-benzimidazole |
| SMILES | Cc1cc(-c2nc3ccccc3[nH]2)ccc1-n1cnnc1 |
| InChI | InChI=1S/C16H13N5/c1-11-8-12(6-7-15(11)21-9-17-18-10-21)16-19-13-4-2-3-5-14(13)20-16/h2-10H,1H3,(H,19,20) |
| InChIKey | JFPHMVMKAHXHBC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |