About 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide
4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide (PubChem CID 50880132) has the molecular formula C16H15FN4OS
and a molecular weight of 330.39 g/mol. Its IUPAC name is 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide.
Molecular Properties
| Compound Name | 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide |
| PubChem CID | 50880132 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide |
| SMILES | Cc1cc2nc(NN)sc2c(C)c1NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN4OS/c1-8-7-12-14(23-16(19-12)21-18)9(2)13(8)20-15(22)10-3-5-11(17)6-4-10/h3-7H,18H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | YEMSSJLELAOOMP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide?
The IUPAC name of 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide (CID 50880132) is 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide.
What is the SMILES notation for 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide?
The canonical SMILES for 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide is Cc1cc2nc(NN)sc2c(C)c1NC(=O)c1ccc(F)cc1.
What is the InChIKey of 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide?
The InChIKey is YEMSSJLELAOOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15FN4OS/c1-8-7-12-14(23-16(19-12)21-18)9(2)13(8)20-15(22)10-3-5-11(17)6-4-10/h3-7H,18H2,1-2H3,(H,19,21)(H,20,22).
What are the key properties of 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide?
4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide has a molecular weight of 330.39 g/mol, XLogP of 3.59, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-N-(2-hydrazinyl-5,7-dimethyl-1,3-benzothiazol-6-yl)benzamide is sourced from PubChem (CID 50880132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).