About (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate
(2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate (PubChem CID 50880279) has the molecular formula C10H9N3S2
and a molecular weight of 235.34 g/mol. Its IUPAC name is (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate.
Molecular Properties
| Compound Name | (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate |
| PubChem CID | 50880279 |
| Molecular Formula | C10H9N3S2 |
| Molecular Weight | 235.34 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate |
| SMILES | Cc1cc2nc(N)sc2c(C)c1SC#N |
| InChI | InChI=1S/C10H9N3S2/c1-5-3-7-9(15-10(12)13-7)6(2)8(5)14-4-11/h3H,1-2H3,(H2,12,13) |
| InChIKey | ZHSHFHXFENHAPZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate?
The IUPAC name of (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate (CID 50880279) is (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate.
What is the SMILES notation for (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate?
The canonical SMILES for (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate is Cc1cc2nc(N)sc2c(C)c1SC#N.
What is the InChIKey of (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate?
The InChIKey is ZHSHFHXFENHAPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3S2/c1-5-3-7-9(15-10(12)13-7)6(2)8(5)14-4-11/h3H,1-2H3,(H2,12,13).
What are the key properties of (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate?
(2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate has a molecular weight of 235.34 g/mol, XLogP of 3.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-5,7-dimethyl-1,3-benzothiazol-6-yl) thiocyanate is sourced from PubChem (CID 50880279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).