About 5-chloro-2-iodo-1,3-dimethylbenzene
5-chloro-2-iodo-1,3-dimethylbenzene (PubChem CID 50880550) has the molecular formula C8H8ClI
and a molecular weight of 266.51 g/mol. Its IUPAC name is 5-chloro-2-iodo-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 5-chloro-2-iodo-1,3-dimethylbenzene |
| PubChem CID | 50880550 |
| Molecular Formula | C8H8ClI |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 265.94 |
| IUPAC Name | 5-chloro-2-iodo-1,3-dimethylbenzene |
| SMILES | Cc1cc(Cl)cc(C)c1I |
| InChI | InChI=1S/C8H8ClI/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
| InChIKey | BYYCLAOKMYRFLD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-iodo-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-iodo-1,3-dimethylbenzene?
The IUPAC name of 5-chloro-2-iodo-1,3-dimethylbenzene (CID 50880550) is 5-chloro-2-iodo-1,3-dimethylbenzene.
What is the SMILES notation for 5-chloro-2-iodo-1,3-dimethylbenzene?
The canonical SMILES for 5-chloro-2-iodo-1,3-dimethylbenzene is Cc1cc(Cl)cc(C)c1I.
What is the InChIKey of 5-chloro-2-iodo-1,3-dimethylbenzene?
The InChIKey is BYYCLAOKMYRFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClI/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3.
What are the key properties of 5-chloro-2-iodo-1,3-dimethylbenzene?
5-chloro-2-iodo-1,3-dimethylbenzene has a molecular weight of 266.51 g/mol, XLogP of 3.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-iodo-1,3-dimethylbenzene is sourced from PubChem (CID 50880550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).