About N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide
N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide (PubChem CID 50881052) has the molecular formula C14H9Cl2N3OS
and a molecular weight of 338.22 g/mol. Its IUPAC name is N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide.
Molecular Properties
| Compound Name | N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide |
| PubChem CID | 50881052 |
| Molecular Formula | C14H9Cl2N3OS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide |
| SMILES | Nc1nc2c(Cl)cc(NC(=O)c3ccccc3)c(Cl)c2s1 |
| InChI | InChI=1S/C14H9Cl2N3OS/c15-8-6-9(10(16)12-11(8)19-14(17)21-12)18-13(20)7-4-2-1-3-5-7/h1-6H,(H2,17,19)(H,18,20) |
| InChIKey | GWNJVAUCKCGXKQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide?
The IUPAC name of N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide (CID 50881052) is N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide.
What is the SMILES notation for N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide?
The canonical SMILES for N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide is Nc1nc2c(Cl)cc(NC(=O)c3ccccc3)c(Cl)c2s1.
What is the InChIKey of N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide?
The InChIKey is GWNJVAUCKCGXKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Cl2N3OS/c15-8-6-9(10(16)12-11(8)19-14(17)21-12)18-13(20)7-4-2-1-3-5-7/h1-6H,(H2,17,19)(H,18,20).
What are the key properties of N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide?
N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide has a molecular weight of 338.22 g/mol, XLogP of 4.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-4,7-dichloro-1,3-benzothiazol-6-yl)benzamide is sourced from PubChem (CID 50881052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).