C18H17Cl2N3O3 — CID 50881507
3-chloro-N-(2-chloro-4-nitro-5-piperidin-1-ylphenyl)benzamide (PubChem CID 50881507) has the molecular formula C18H17Cl2N3O3 and a molecular weight of 394.26 g/mol. Its IUPAC name is 3-chloro-N-(2-chloro-4-nitro-5-piperidin-1-ylphenyl)benzamide.
| Compound Name | 3-chloro-N-(2-chloro-4-nitro-5-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 50881507 |
| Molecular Formula | C18H17Cl2N3O3 |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-chloro-N-(2-chloro-4-nitro-5-piperidin-1-ylphenyl)benzamide |
| SMILES | O=C(Nc1cc(N2CCCCC2)c([N+](=O)[O-])cc1Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N3O3/c19-13-6-4-5-12(9-13)18(24)21-15-11-16(22-7-2-1-3-8-22)17(23(25)26)10-14(15)20/h4-6,9-11H,1-3,7-8H2,(H,21,24) |
| InChIKey | MDNKFFVTMSTLDW-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|